C24H21F3N4O2 — CID 171903674
2-oxo-N-[phenyl-(4-pyrimidin-2-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903674) has the molecular formula C24H21F3N4O2 and a molecular weight of 454.45 g/mol. Its IUPAC name is 2-oxo-N-[phenyl-(4-pyrimidin-2-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | 2-oxo-N-[phenyl-(4-pyrimidin-2-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903674 |
| Molecular Formula | C24H21F3N4O2 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 2-oxo-N-[phenyl-(4-pyrimidin-2-ylphenyl)methyl]-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | O=C(NC(c1ccccc1)c1ccc(-c2ncccn2)cc1)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C24H21F3N4O2/c25-24(26,27)19-12-11-18(22(32)30-19)23(33)31-20(15-5-2-1-3-6-15)16-7-9-17(10-8-16)21-28-13-4-14-29-21/h1-10,13-14,18-20H,11-12H2,(H,30,32)(H,31,33) |
| InChIKey | JTWFFJGYXXFMNA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|