C22H29F3N2O2 — CID 171903961
N-[2-cyclohexyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903961) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is N-[2-cyclohexyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[2-cyclohexyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903961 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[2-cyclohexyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C(CC2CCCCC2)NC(=O)C2CCC(C(F)(F)F)NC2=O)cc1 |
| InChI | InChI=1S/C22H29F3N2O2/c1-14-7-9-16(10-8-14)18(13-15-5-3-2-4-6-15)26-20(28)17-11-12-19(22(23,24)25)27-21(17)29/h7-10,15,17-19H,2-6,11-13H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | PJGXNEHIBSYIJK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|