C21H23F3N2O2 — CID 171903982
N-[2-cyclopentyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)-3H-pyridine-3-carboxamide (PubChem CID 171903982) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is N-[2-cyclopentyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)-3H-pyridine-3-carboxamide.
| Compound Name | N-[2-cyclopentyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)-3H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 171903982 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[2-cyclopentyl-1-(4-methylphenyl)ethyl]-2-oxo-6-(trifluoromethyl)-3H-pyridine-3-carboxamide |
| SMILES | Cc1ccc(C(CC2CCCC2)NC(=O)C2C=CC(C(F)(F)F)=NC2=O)cc1 |
| InChI | InChI=1S/C21H23F3N2O2/c1-13-6-8-15(9-7-13)17(12-14-4-2-3-5-14)25-19(27)16-10-11-18(21(22,23)24)26-20(16)28/h6-11,14,16-17H,2-5,12H2,1H3,(H,25,27) |
| InChIKey | QUJQKMHSBIGHMN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|