C16H15F3N2O3 — CID 171904032
N-(6-methyl-1-benzofuran-3-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171904032) has the molecular formula C16H15F3N2O3 and a molecular weight of 340.30 g/mol. Its IUPAC name is N-(6-methyl-1-benzofuran-3-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(6-methyl-1-benzofuran-3-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171904032 |
| Molecular Formula | C16H15F3N2O3 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-(6-methyl-1-benzofuran-3-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc2c(NC(=O)C3CCC(C(F)(F)F)NC3=O)coc2c1 |
| InChI | InChI=1S/C16H15F3N2O3/c1-8-2-3-9-11(7-24-12(9)6-8)20-14(22)10-4-5-13(16(17,18)19)21-15(10)23/h2-3,6-7,10,13H,4-5H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | SBFNATLKUNUALG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|