C14H14O2S2 — CID 114725755
1,4-dithian-2-yl-(5-methyl-1-benzofuran-2-yl)methanone (PubChem CID 114725755) has the molecular formula C14H14O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1,4-dithian-2-yl-(5-methyl-1-benzofuran-2-yl)methanone.
| Compound Name | 1,4-dithian-2-yl-(5-methyl-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 114725755 |
| Molecular Formula | C14H14O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1,4-dithian-2-yl-(5-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1ccc2oc(C(=O)C3CSCCS3)cc2c1 |
| InChI | InChI=1S/C14H14O2S2/c1-9-2-3-11-10(6-9)7-12(16-11)14(15)13-8-17-4-5-18-13/h2-3,6-7,13H,4-5,8H2,1H3 |
| InChIKey | FMYQTLHJRCRHEA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |