C17H21NO2 — CID 114737007
[4-(aminomethyl)cyclohexyl]-(5-methyl-1-benzofuran-2-yl)methanone (PubChem CID 114737007) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is [4-(aminomethyl)cyclohexyl]-(5-methyl-1-benzofuran-2-yl)methanone.
| Compound Name | [4-(aminomethyl)cyclohexyl]-(5-methyl-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 114737007 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | [4-(aminomethyl)cyclohexyl]-(5-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1ccc2oc(C(=O)C3CCC(CN)CC3)cc2c1 |
| InChI | InChI=1S/C17H21NO2/c1-11-2-7-15-14(8-11)9-16(20-15)17(19)13-5-3-12(10-18)4-6-13/h2,7-9,12-13H,3-6,10,18H2,1H3 |
| InChIKey | IIVJELXYFLTLFM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |