C16H18FNO2 — CID 114737005
[4-(aminomethyl)cyclohexyl]-(7-fluoro-1-benzofuran-2-yl)methanone (PubChem CID 114737005) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is [4-(aminomethyl)cyclohexyl]-(7-fluoro-1-benzofuran-2-yl)methanone.
| Compound Name | [4-(aminomethyl)cyclohexyl]-(7-fluoro-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 114737005 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | [4-(aminomethyl)cyclohexyl]-(7-fluoro-1-benzofuran-2-yl)methanone |
| SMILES | NCC1CCC(C(=O)c2cc3cccc(F)c3o2)CC1 |
| InChI | InChI=1S/C16H18FNO2/c17-13-3-1-2-12-8-14(20-16(12)13)15(19)11-6-4-10(9-18)5-7-11/h1-3,8,10-11H,4-7,9,18H2 |
| InChIKey | AWTJVRUMHILCOV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |