C13H12FNO2S — CID 114737342
(7-fluoro-1-benzofuran-2-yl)-thiomorpholin-3-ylmethanone (PubChem CID 114737342) has the molecular formula C13H12FNO2S and a molecular weight of 265.31 g/mol. Its IUPAC name is (7-fluoro-1-benzofuran-2-yl)-thiomorpholin-3-ylmethanone.
| Compound Name | (7-fluoro-1-benzofuran-2-yl)-thiomorpholin-3-ylmethanone |
|---|---|
| PubChem CID | 114737342 |
| Molecular Formula | C13H12FNO2S |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (7-fluoro-1-benzofuran-2-yl)-thiomorpholin-3-ylmethanone |
| SMILES | O=C(c1cc2cccc(F)c2o1)C1CSCCN1 |
| InChI | InChI=1S/C13H12FNO2S/c14-9-3-1-2-8-6-11(17-13(8)9)12(16)10-7-18-5-4-15-10/h1-3,6,10,15H,4-5,7H2 |
| InChIKey | MWTOMEJYIJGJIG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |