C17H19FO2 — CID 115809805
2-cycloheptyl-1-(7-fluoro-1-benzofuran-2-yl)ethanone (PubChem CID 115809805) has the molecular formula C17H19FO2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-cycloheptyl-1-(7-fluoro-1-benzofuran-2-yl)ethanone.
| Compound Name | 2-cycloheptyl-1-(7-fluoro-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 115809805 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-cycloheptyl-1-(7-fluoro-1-benzofuran-2-yl)ethanone |
| SMILES | O=C(CC1CCCCCC1)c1cc2cccc(F)c2o1 |
| InChI | InChI=1S/C17H19FO2/c18-14-9-5-8-13-11-16(20-17(13)14)15(19)10-12-6-3-1-2-4-7-12/h5,8-9,11-12H,1-4,6-7,10H2 |
| InChIKey | MLXXSXHQOHOOQA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |