C17H20O2 — CID 115808413
2-cyclohexyl-1-(7-methyl-1-benzofuran-2-yl)ethanone (PubChem CID 115808413) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2-cyclohexyl-1-(7-methyl-1-benzofuran-2-yl)ethanone.
| Compound Name | 2-cyclohexyl-1-(7-methyl-1-benzofuran-2-yl)ethanone |
|---|---|
| PubChem CID | 115808413 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-cyclohexyl-1-(7-methyl-1-benzofuran-2-yl)ethanone |
| SMILES | Cc1cccc2cc(C(=O)CC3CCCCC3)oc12 |
| InChI | InChI=1S/C17H20O2/c1-12-6-5-9-14-11-16(19-17(12)14)15(18)10-13-7-3-2-4-8-13/h5-6,9,11,13H,2-4,7-8,10H2,1H3 |
| InChIKey | BXILLLDTVWYROX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |