C16H18FNO3 — CID 114725740
(7-fluoro-1-benzofuran-2-yl)-(4-propan-2-ylmorpholin-2-yl)methanone (PubChem CID 114725740) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is (7-fluoro-1-benzofuran-2-yl)-(4-propan-2-ylmorpholin-2-yl)methanone.
| Compound Name | (7-fluoro-1-benzofuran-2-yl)-(4-propan-2-ylmorpholin-2-yl)methanone |
|---|---|
| PubChem CID | 114725740 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (7-fluoro-1-benzofuran-2-yl)-(4-propan-2-ylmorpholin-2-yl)methanone |
| SMILES | CC(C)N1CCOC(C(=O)c2cc3cccc(F)c3o2)C1 |
| InChI | InChI=1S/C16H18FNO3/c1-10(2)18-6-7-20-14(9-18)15(19)13-8-11-4-3-5-12(17)16(11)21-13/h3-5,8,10,14H,6-7,9H2,1-2H3 |
| InChIKey | XKBHFHDXTZPZOF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |