C12H12Cl2OS2 — CID 79972598
2-(2,6-dichlorophenyl)-1-(1,4-dithian-2-yl)ethanone (PubChem CID 79972598) has the molecular formula C12H12Cl2OS2 and a molecular weight of 307.27 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(1,4-dithian-2-yl)ethanone.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 79972598 |
| Molecular Formula | C12H12Cl2OS2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(1,4-dithian-2-yl)ethanone |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)C1CSCCS1 |
| InChI | InChI=1S/C12H12Cl2OS2/c13-9-2-1-3-10(14)8(9)6-11(15)12-7-16-4-5-17-12/h1-3,12H,4-7H2 |
| InChIKey | XMFALRFHUDJYKC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |