C11H14N2OS2 — CID 79971866
2-(2-amino-4-pyridinyl)-1-(1,4-dithian-2-yl)ethanone (PubChem CID 79971866) has the molecular formula C11H14N2OS2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-(2-amino-4-pyridinyl)-1-(1,4-dithian-2-yl)ethanone.
| Compound Name | 2-(2-amino-4-pyridinyl)-1-(1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 79971866 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 2-(2-amino-4-pyridinyl)-1-(1,4-dithian-2-yl)ethanone |
| SMILES | Nc1cc(CC(=O)C2CSCCS2)ccn1 |
| InChI | InChI=1S/C11H14N2OS2/c12-11-6-8(1-2-13-11)5-9(14)10-7-15-3-4-16-10/h1-2,6,10H,3-5,7H2,(H2,12,13) |
| InChIKey | DNFBZKILHSSHGE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |