C11H16N2OS2 — CID 79972065
1-(1,4-dithian-2-yl)-2-(1-ethylimidazol-2-yl)ethanone (PubChem CID 79972065) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is 1-(1,4-dithian-2-yl)-2-(1-ethylimidazol-2-yl)ethanone.
| Compound Name | 1-(1,4-dithian-2-yl)-2-(1-ethylimidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 79972065 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 1-(1,4-dithian-2-yl)-2-(1-ethylimidazol-2-yl)ethanone |
| SMILES | CCn1ccnc1CC(=O)C1CSCCS1 |
| InChI | InChI=1S/C11H16N2OS2/c1-2-13-4-3-12-11(13)7-9(14)10-8-15-5-6-16-10/h3-4,10H,2,5-8H2,1H3 |
| InChIKey | AVIQGFAISCMLOL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |