C12H19N3S2 — CID 79966342
4-[2-(1,4-dithian-2-yl)-2-(methylamino)ethyl]pyridin-2-amine (PubChem CID 79966342) has the molecular formula C12H19N3S2 and a molecular weight of 269.44 g/mol. Its IUPAC name is 4-[2-(1,4-dithian-2-yl)-2-(methylamino)ethyl]pyridin-2-amine.
| Compound Name | 4-[2-(1,4-dithian-2-yl)-2-(methylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79966342 |
| Molecular Formula | C12H19N3S2 |
| Molecular Weight | 269.44 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[2-(1,4-dithian-2-yl)-2-(methylamino)ethyl]pyridin-2-amine |
| SMILES | CNC(Cc1ccnc(N)c1)C1CSCCS1 |
| InChI | InChI=1S/C12H19N3S2/c1-14-10(11-8-16-4-5-17-11)6-9-2-3-15-12(13)7-9/h2-3,7,10-11,14H,4-6,8H2,1H3,(H2,13,15) |
| InChIKey | BTAQNXUJHDNIKC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |