C12H20N4S2 — CID 105259577
4-[2-hydrazinyl-2-(3-methyl-1,4-dithian-2-yl)ethyl]pyridin-2-amine (PubChem CID 105259577) has the molecular formula C12H20N4S2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 4-[2-hydrazinyl-2-(3-methyl-1,4-dithian-2-yl)ethyl]pyridin-2-amine.
| Compound Name | 4-[2-hydrazinyl-2-(3-methyl-1,4-dithian-2-yl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105259577 |
| Molecular Formula | C12H20N4S2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-[2-hydrazinyl-2-(3-methyl-1,4-dithian-2-yl)ethyl]pyridin-2-amine |
| SMILES | CC1SCCSC1C(Cc1ccnc(N)c1)NN |
| InChI | InChI=1S/C12H20N4S2/c1-8-12(18-5-4-17-8)10(16-14)6-9-2-3-15-11(13)7-9/h2-3,7-8,10,12,16H,4-6,14H2,1H3,(H2,13,15) |
| InChIKey | VMNDPXGVOBHOND-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|