C16H21N3S2 — CID 105259589
[1-(3-methyl-1,4-dithian-2-yl)-2-quinolin-4-ylethyl]hydrazine (PubChem CID 105259589) has the molecular formula C16H21N3S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is [1-(3-methyl-1,4-dithian-2-yl)-2-quinolin-4-ylethyl]hydrazine.
| Compound Name | [1-(3-methyl-1,4-dithian-2-yl)-2-quinolin-4-ylethyl]hydrazine |
|---|---|
| PubChem CID | 105259589 |
| Molecular Formula | C16H21N3S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [1-(3-methyl-1,4-dithian-2-yl)-2-quinolin-4-ylethyl]hydrazine |
| SMILES | CC1SCCSC1C(Cc1ccnc2ccccc12)NN |
| InChI | InChI=1S/C16H21N3S2/c1-11-16(21-9-8-20-11)15(19-17)10-12-6-7-18-14-5-3-2-4-13(12)14/h2-7,11,15-16,19H,8-10,17H2,1H3 |
| InChIKey | ROHIXKXDNZRXRP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|