C18H25N3 — CID 107194203
[1-(2,2-dimethylcyclopentyl)-2-quinolin-4-ylethyl]hydrazine (PubChem CID 107194203) has the molecular formula C18H25N3 and a molecular weight of 283.42 g/mol. Its IUPAC name is [1-(2,2-dimethylcyclopentyl)-2-quinolin-4-ylethyl]hydrazine.
| Compound Name | [1-(2,2-dimethylcyclopentyl)-2-quinolin-4-ylethyl]hydrazine |
|---|---|
| PubChem CID | 107194203 |
| Molecular Formula | C18H25N3 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.20 |
| IUPAC Name | [1-(2,2-dimethylcyclopentyl)-2-quinolin-4-ylethyl]hydrazine |
| SMILES | CC1(C)CCCC1C(Cc1ccnc2ccccc12)NN |
| InChI | InChI=1S/C18H25N3/c1-18(2)10-5-7-15(18)17(21-19)12-13-9-11-20-16-8-4-3-6-14(13)16/h3-4,6,8-9,11,15,17,21H,5,7,10,12,19H2,1-2H3 |
| InChIKey | FQMXKPUTZMRIJU-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|