C11H17BrN2S3 — CID 105259686
[2-(4-bromothiophen-2-yl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine (PubChem CID 105259686) has the molecular formula C11H17BrN2S3 and a molecular weight of 353.38 g/mol. Its IUPAC name is [2-(4-bromothiophen-2-yl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(4-bromothiophen-2-yl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105259686 |
| Molecular Formula | C11H17BrN2S3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | [2-(4-bromothiophen-2-yl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine |
| SMILES | CC1SCCSC1C(Cc1cc(Br)cs1)NN |
| InChI | InChI=1S/C11H17BrN2S3/c1-7-11(16-3-2-15-7)10(14-13)5-9-4-8(12)6-17-9/h4,6-7,10-11,14H,2-3,5,13H2,1H3 |
| InChIKey | OKWSSDAAGOFDTP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|