C12H18BrNS2 — CID 80621687
2-(4-bromothiophen-2-yl)-N-ethyl-1-(thiolan-2-yl)ethanamine (PubChem CID 80621687) has the molecular formula C12H18BrNS2 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-ethyl-1-(thiolan-2-yl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-ethyl-1-(thiolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 80621687 |
| Molecular Formula | C12H18BrNS2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-ethyl-1-(thiolan-2-yl)ethanamine |
| SMILES | CCNC(Cc1cc(Br)cs1)C1CCCS1 |
| InChI | InChI=1S/C12H18BrNS2/c1-2-14-11(12-4-3-5-15-12)7-10-6-9(13)8-16-10/h6,8,11-12,14H,2-5,7H2,1H3 |
| InChIKey | NCPPJOPFINEMFR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |