C15H23BrN2OS — CID 79089609
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-bromothiophen-2-yl)-N-ethylethanamine (PubChem CID 79089609) has the molecular formula C15H23BrN2OS and a molecular weight of 359.33 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-bromothiophen-2-yl)-N-ethylethanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-bromothiophen-2-yl)-N-ethylethanamine |
|---|---|
| PubChem CID | 79089609 |
| Molecular Formula | C15H23BrN2OS |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-2-(4-bromothiophen-2-yl)-N-ethylethanamine |
| SMILES | CCNC(Cc1cc(Br)cs1)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H23BrN2OS/c1-2-17-14(7-13-6-11(16)10-20-13)15-8-18-5-3-4-12(18)9-19-15/h6,10,12,14-15,17H,2-5,7-9H2,1H3 |
| InChIKey | SBVYRKLZLBYKOE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |