C15H25BrN2OS — CID 79658332
2-(4-bromothiophen-2-yl)-N-ethyl-1-(4-propylmorpholin-2-yl)ethanamine (PubChem CID 79658332) has the molecular formula C15H25BrN2OS and a molecular weight of 361.35 g/mol. Its IUPAC name is 2-(4-bromothiophen-2-yl)-N-ethyl-1-(4-propylmorpholin-2-yl)ethanamine.
| Compound Name | 2-(4-bromothiophen-2-yl)-N-ethyl-1-(4-propylmorpholin-2-yl)ethanamine |
|---|---|
| PubChem CID | 79658332 |
| Molecular Formula | C15H25BrN2OS |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-(4-bromothiophen-2-yl)-N-ethyl-1-(4-propylmorpholin-2-yl)ethanamine |
| SMILES | CCCN1CCOC(C(Cc2cc(Br)cs2)NCC)C1 |
| InChI | InChI=1S/C15H25BrN2OS/c1-3-5-18-6-7-19-15(10-18)14(17-4-2)9-13-8-12(16)11-20-13/h8,11,14-15,17H,3-7,9-10H2,1-2H3 |
| InChIKey | UWNTXBSMJGNWSC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |