C15H26N2OS — CID 79657173
N-ethyl-1-(4-propylmorpholin-2-yl)-2-thiophen-3-ylethanamine (PubChem CID 79657173) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is N-ethyl-1-(4-propylmorpholin-2-yl)-2-thiophen-3-ylethanamine.
| Compound Name | N-ethyl-1-(4-propylmorpholin-2-yl)-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 79657173 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | N-ethyl-1-(4-propylmorpholin-2-yl)-2-thiophen-3-ylethanamine |
| SMILES | CCCN1CCOC(C(Cc2ccsc2)NCC)C1 |
| InChI | InChI=1S/C15H26N2OS/c1-3-6-17-7-8-18-15(11-17)14(16-4-2)10-13-5-9-19-12-13/h5,9,12,14-16H,3-4,6-8,10-11H2,1-2H3 |
| InChIKey | MITUBEOYLVHKHX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |