C14H28N2O2 — CID 79569697
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-ethyl-2-propan-2-yloxyethanamine (PubChem CID 79569697) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-ethyl-2-propan-2-yloxyethanamine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-ethyl-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 79569697 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-N-ethyl-2-propan-2-yloxyethanamine |
| SMILES | CCNC(COC(C)C)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H28N2O2/c1-4-15-13(10-17-11(2)3)14-8-16-7-5-6-12(16)9-18-14/h11-15H,4-10H2,1-3H3 |
| InChIKey | XRBBSQNUXQMAHX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |