C14H21BrN2OS — CID 79602155
N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-bromothiophen-3-yl)methyl]ethanamine (PubChem CID 79602155) has the molecular formula C14H21BrN2OS and a molecular weight of 345.31 g/mol. Its IUPAC name is N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-bromothiophen-3-yl)methyl]ethanamine.
| Compound Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-bromothiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 79602155 |
| Molecular Formula | C14H21BrN2OS |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(4-bromothiophen-3-yl)methyl]ethanamine |
| SMILES | CCNC(c1cscc1Br)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C14H21BrN2OS/c1-2-16-14(11-8-19-9-12(11)15)13-6-17-5-3-4-10(17)7-18-13/h8-10,13-14,16H,2-7H2,1H3 |
| InChIKey | UTHBKBNOWYMPHX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |