C15H22FN3O — CID 104738494
N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(3-fluoro-4-pyridinyl)methyl]ethanamine (PubChem CID 104738494) has the molecular formula C15H22FN3O and a molecular weight of 279.36 g/mol. Its IUPAC name is N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(3-fluoro-4-pyridinyl)methyl]ethanamine.
| Compound Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(3-fluoro-4-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 104738494 |
| Molecular Formula | C15H22FN3O |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl-(3-fluoro-4-pyridinyl)methyl]ethanamine |
| SMILES | CCNC(c1ccncc1F)C1CN2CCCC2CO1 |
| InChI | InChI=1S/C15H22FN3O/c1-2-18-15(12-5-6-17-8-13(12)16)14-9-19-7-3-4-11(19)10-20-14/h5-6,8,11,14-15,18H,2-4,7,9-10H2,1H3 |
| InChIKey | IEKXQAHQVKHKGO-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |