C8H13BrN2S — CID 105201113
1-(4-bromothiophen-2-yl)butan-2-ylhydrazine (PubChem CID 105201113) has the molecular formula C8H13BrN2S and a molecular weight of 249.18 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)butan-2-ylhydrazine.
| Compound Name | 1-(4-bromothiophen-2-yl)butan-2-ylhydrazine |
|---|---|
| PubChem CID | 105201113 |
| Molecular Formula | C8H13BrN2S |
| Molecular Weight | 249.18 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)butan-2-ylhydrazine |
| SMILES | CCC(Cc1cc(Br)cs1)NN |
| InChI | InChI=1S/C8H13BrN2S/c1-2-7(11-10)4-8-3-6(9)5-12-8/h3,5,7,11H,2,4,10H2,1H3 |
| InChIKey | LYSLTEUAGHHSEB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|