C11H18BrNS — CID 62601735
1-(4-bromothiophen-2-yl)-N-propylbutan-2-amine (PubChem CID 62601735) has the molecular formula C11H18BrNS and a molecular weight of 276.24 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-N-propylbutan-2-amine.
| Compound Name | 1-(4-bromothiophen-2-yl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 62601735 |
| Molecular Formula | C11H18BrNS |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CC)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C11H18BrNS/c1-3-5-13-10(4-2)7-11-6-9(12)8-14-11/h6,8,10,13H,3-5,7H2,1-2H3 |
| InChIKey | CJBBFHQLDFCTLH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |