C13H24BrN3S — CID 105241832
1-(4-bromothiophen-2-yl)-3-ethyl-2-hydrazinyl-N,N-dimethylpentan-3-amine (PubChem CID 105241832) has the molecular formula C13H24BrN3S and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-(4-bromothiophen-2-yl)-3-ethyl-2-hydrazinyl-N,N-dimethylpentan-3-amine.
| Compound Name | 1-(4-bromothiophen-2-yl)-3-ethyl-2-hydrazinyl-N,N-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 105241832 |
| Molecular Formula | C13H24BrN3S |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 1-(4-bromothiophen-2-yl)-3-ethyl-2-hydrazinyl-N,N-dimethylpentan-3-amine |
| SMILES | CCC(CC)(C(Cc1cc(Br)cs1)NN)N(C)C |
| InChI | InChI=1S/C13H24BrN3S/c1-5-13(6-2,17(3)4)12(16-15)8-11-7-10(14)9-18-11/h7,9,12,16H,5-6,8,15H2,1-4H3 |
| InChIKey | GPTNSQDBUFXYDI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|