C14H27N5 — CID 105241861
3-[3-(dimethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine (PubChem CID 105241861) has the molecular formula C14H27N5 and a molecular weight of 265.40 g/mol. Its IUPAC name is 3-[3-(dimethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine.
| Compound Name | 3-[3-(dimethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine |
|---|---|
| PubChem CID | 105241861 |
| Molecular Formula | C14H27N5 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.23 |
| IUPAC Name | 3-[3-(dimethylamino)-3-ethyl-2-hydrazinylpentyl]pyridin-2-amine |
| SMILES | CCC(CC)(C(Cc1cccnc1N)NN)N(C)C |
| InChI | InChI=1S/C14H27N5/c1-5-14(6-2,19(3)4)12(18-16)10-11-8-7-9-17-13(11)15/h7-9,12,18H,5-6,10,16H2,1-4H3,(H2,15,17) |
| InChIKey | FTNLCHWZKZRDDK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|