C15H17F2N3 — CID 79522491
3-[2-(2,6-difluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine (PubChem CID 79522491) has the molecular formula C15H17F2N3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[2-(2,6-difluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-(2,6-difluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79522491 |
| Molecular Formula | C15H17F2N3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 3-[2-(2,6-difluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine |
| SMILES | CCNC(Cc1cccnc1N)c1c(F)cccc1F |
| InChI | InChI=1S/C15H17F2N3/c1-2-19-13(9-10-5-4-8-20-15(10)18)14-11(16)6-3-7-12(14)17/h3-8,13,19H,2,9H2,1H3,(H2,18,20) |
| InChIKey | HKLVXPTWISHCTR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |