C15H17BrFN3 — CID 114894906
3-[2-(5-bromo-2-fluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine (PubChem CID 114894906) has the molecular formula C15H17BrFN3 and a molecular weight of 338.22 g/mol. Its IUPAC name is 3-[2-(5-bromo-2-fluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-(5-bromo-2-fluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 114894906 |
| Molecular Formula | C15H17BrFN3 |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 3-[2-(5-bromo-2-fluorophenyl)-2-(ethylamino)ethyl]pyridin-2-amine |
| SMILES | CCNC(Cc1cccnc1N)c1cc(Br)ccc1F |
| InChI | InChI=1S/C15H17BrFN3/c1-2-19-14(8-10-4-3-7-20-15(10)18)12-9-11(16)5-6-13(12)17/h3-7,9,14,19H,2,8H2,1H3,(H2,18,20) |
| InChIKey | SCNUAOXGGNCSNA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |