C16H19F2N3 — CID 79517746
3-[2-(2,6-difluorophenyl)-2-(propylamino)ethyl]pyridin-2-amine (PubChem CID 79517746) has the molecular formula C16H19F2N3 and a molecular weight of 291.34 g/mol. Its IUPAC name is 3-[2-(2,6-difluorophenyl)-2-(propylamino)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-(2,6-difluorophenyl)-2-(propylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 79517746 |
| Molecular Formula | C16H19F2N3 |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-[2-(2,6-difluorophenyl)-2-(propylamino)ethyl]pyridin-2-amine |
| SMILES | CCCNC(Cc1cccnc1N)c1c(F)cccc1F |
| InChI | InChI=1S/C16H19F2N3/c1-2-8-20-14(10-11-5-4-9-21-16(11)19)15-12(17)6-3-7-13(15)18/h3-7,9,14,20H,2,8,10H2,1H3,(H2,19,21) |
| InChIKey | ZVFXWPZSHPJRIM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |