C17H22FN3 — CID 81269673
3-[2-(4-fluoro-2-methylphenyl)-2-(propylamino)ethyl]pyridin-2-amine (PubChem CID 81269673) has the molecular formula C17H22FN3 and a molecular weight of 287.38 g/mol. Its IUPAC name is 3-[2-(4-fluoro-2-methylphenyl)-2-(propylamino)ethyl]pyridin-2-amine.
| Compound Name | 3-[2-(4-fluoro-2-methylphenyl)-2-(propylamino)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 81269673 |
| Molecular Formula | C17H22FN3 |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.18 |
| IUPAC Name | 3-[2-(4-fluoro-2-methylphenyl)-2-(propylamino)ethyl]pyridin-2-amine |
| SMILES | CCCNC(Cc1cccnc1N)c1ccc(F)cc1C |
| InChI | InChI=1S/C17H22FN3/c1-3-8-20-16(11-13-5-4-9-21-17(13)19)15-7-6-14(18)10-12(15)2/h4-7,9-10,16,20H,3,8,11H2,1-2H3,(H2,19,21) |
| InChIKey | GBEYEDYXWAFZFK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |