C8H13BrN2O2S2 — CID 105299404
[1-(4-bromothiophen-2-yl)-3-methylsulfonylpropan-2-yl]hydrazine (PubChem CID 105299404) has the molecular formula C8H13BrN2O2S2 and a molecular weight of 313.24 g/mol. Its IUPAC name is [1-(4-bromothiophen-2-yl)-3-methylsulfonylpropan-2-yl]hydrazine.
| Compound Name | [1-(4-bromothiophen-2-yl)-3-methylsulfonylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105299404 |
| Molecular Formula | C8H13BrN2O2S2 |
| Molecular Weight | 313.24 g/mol |
| Exact Mass | 311.96 |
| IUPAC Name | [1-(4-bromothiophen-2-yl)-3-methylsulfonylpropan-2-yl]hydrazine |
| SMILES | CS(=O)(=O)CC(Cc1cc(Br)cs1)NN |
| InChI | InChI=1S/C8H13BrN2O2S2/c1-15(12,13)5-7(11-10)3-8-2-6(9)4-14-8/h2,4,7,11H,3,5,10H2,1H3 |
| InChIKey | VHPZCEYYIPXBFJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|