C10H14BrFN2O2S — CID 105324883
[1-(3-bromo-5-fluorophenyl)-3-methylsulfonylpropan-2-yl]hydrazine (PubChem CID 105324883) has the molecular formula C10H14BrFN2O2S and a molecular weight of 325.20 g/mol. Its IUPAC name is [1-(3-bromo-5-fluorophenyl)-3-methylsulfonylpropan-2-yl]hydrazine.
| Compound Name | [1-(3-bromo-5-fluorophenyl)-3-methylsulfonylpropan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105324883 |
| Molecular Formula | C10H14BrFN2O2S |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | [1-(3-bromo-5-fluorophenyl)-3-methylsulfonylpropan-2-yl]hydrazine |
| SMILES | CS(=O)(=O)CC(Cc1cc(F)cc(Br)c1)NN |
| InChI | InChI=1S/C10H14BrFN2O2S/c1-17(15,16)6-10(14-13)4-7-2-8(11)5-9(12)3-7/h2-3,5,10,14H,4,6,13H2,1H3 |
| InChIKey | YERLMSXZYUKINH-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|