C13H18BrFN2S2 — CID 105259504
[2-(2-bromo-3-fluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine (PubChem CID 105259504) has the molecular formula C13H18BrFN2S2 and a molecular weight of 365.34 g/mol. Its IUPAC name is [2-(2-bromo-3-fluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine.
| Compound Name | [2-(2-bromo-3-fluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105259504 |
| Molecular Formula | C13H18BrFN2S2 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | [2-(2-bromo-3-fluorophenyl)-1-(3-methyl-1,4-dithian-2-yl)ethyl]hydrazine |
| SMILES | CC1SCCSC1C(Cc1cccc(F)c1Br)NN |
| InChI | InChI=1S/C13H18BrFN2S2/c1-8-13(19-6-5-18-8)11(17-16)7-9-3-2-4-10(15)12(9)14/h2-4,8,11,13,17H,5-7,16H2,1H3 |
| InChIKey | YXVJROIJBGWXNU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|