C13H20N2S2 — CID 105249241
[1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethyl]hydrazine (PubChem CID 105249241) has the molecular formula C13H20N2S2 and a molecular weight of 268.45 g/mol. Its IUPAC name is [1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethyl]hydrazine.
| Compound Name | [1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105249241 |
| Molecular Formula | C13H20N2S2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | [1-(1,4-dithian-2-yl)-2-(3-methylphenyl)ethyl]hydrazine |
| SMILES | Cc1cccc(CC(NN)C2CSCCS2)c1 |
| InChI | InChI=1S/C13H20N2S2/c1-10-3-2-4-11(7-10)8-12(15-14)13-9-16-5-6-17-13/h2-4,7,12-13,15H,5-6,8-9,14H2,1H3 |
| InChIKey | UDZWXZHHANIUPO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|