C12H13BrOS2 — CID 79972243
2-(2-bromophenyl)-1-(1,4-dithian-2-yl)ethanone (PubChem CID 79972243) has the molecular formula C12H13BrOS2 and a molecular weight of 317.27 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-(1,4-dithian-2-yl)ethanone.
| Compound Name | 2-(2-bromophenyl)-1-(1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 79972243 |
| Molecular Formula | C12H13BrOS2 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 2-(2-bromophenyl)-1-(1,4-dithian-2-yl)ethanone |
| SMILES | O=C(Cc1ccccc1Br)C1CSCCS1 |
| InChI | InChI=1S/C12H13BrOS2/c13-10-4-2-1-3-9(10)7-11(14)12-8-15-5-6-16-12/h1-4,12H,5-8H2 |
| InChIKey | ZIJBTLMOJWZXAM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |