C18H23O3- — CID 9437111
(4bS,8aS)-2-methoxy-6,6-dimethyl-4b,5,7,8,9,10-hexahydrophenanthrene-8a-carboxylate (PubChem CID 9437111) has the molecular formula C18H23O3- and a molecular weight of 287.38 g/mol. Its IUPAC name is (4bS,8aS)-2-methoxy-6,6-dimethyl-4b,5,7,8,9,10-hexahydrophenanthrene-8a-carboxylate.
| Compound Name | (4bS,8aS)-2-methoxy-6,6-dimethyl-4b,5,7,8,9,10-hexahydrophenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 9437111 |
| Molecular Formula | C18H23O3- |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (4bS,8aS)-2-methoxy-6,6-dimethyl-4b,5,7,8,9,10-hexahydrophenanthrene-8a-carboxylate |
| SMILES | COc1ccc2c(c1)CC[C@@]1(C(=O)[O-])CCC(C)(C)C[C@@H]21 |
| InChI | InChI=1S/C18H24O3/c1-17(2)8-9-18(16(19)20)7-6-12-10-13(21-3)4-5-14(12)15(18)11-17/h4-5,10,15H,6-9,11H2,1-3H3,(H,19,20)/p-1/t15-,18+/m0/s1 |
| InChIKey | RMLPCMXTLPJHFJ-MAUKXSAKSA-M |
| XLogP | 2.67 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |