C18H23NO2 — CID 59678876
1-[(1R,10S,13S)-6-methoxy-15-azatetracyclo[8.6.0.01,13.04,9]hexadeca-4(9),5,7-trien-15-yl]ethanone (PubChem CID 59678876) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 1-[(1R,10S,13S)-6-methoxy-15-azatetracyclo[8.6.0.01,13.04,9]hexadeca-4(9),5,7-trien-15-yl]ethanone.
| Compound Name | 1-[(1R,10S,13S)-6-methoxy-15-azatetracyclo[8.6.0.01,13.04,9]hexadeca-4(9),5,7-trien-15-yl]ethanone |
|---|---|
| PubChem CID | 59678876 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[(1R,10S,13S)-6-methoxy-15-azatetracyclo[8.6.0.01,13.04,9]hexadeca-4(9),5,7-trien-15-yl]ethanone |
| SMILES | COc1ccc2c(c1)CC[C@]13CN(C(C)=O)C[C@H]1CC[C@@H]23 |
| InChI | InChI=1S/C18H23NO2/c1-12(20)19-10-14-3-6-17-16-5-4-15(21-2)9-13(16)7-8-18(14,17)11-19/h4-5,9,14,17H,3,6-8,10-11H2,1-2H3/t14-,17+,18+/m1/s1 |
| InChIKey | BEJJTGJQNLUGBI-JLSDUUJJSA-N |
| XLogP | 2.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |