C27H32O3 — CID 166832903
(13S)-3,16-dimethoxy-9-(4-methoxyphenyl)-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene (PubChem CID 166832903) has the molecular formula C27H32O3 and a molecular weight of 404.55 g/mol. Its IUPAC name is (13S)-3,16-dimethoxy-9-(4-methoxyphenyl)-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene.
| Compound Name | (13S)-3,16-dimethoxy-9-(4-methoxyphenyl)-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 166832903 |
| Molecular Formula | C27H32O3 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (13S)-3,16-dimethoxy-9-(4-methoxyphenyl)-13-methyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene |
| SMILES | COc1ccc(C23CC[C@@]4(C)CC(OC)CC4=C2CCc2cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C27H32O3/c1-26-13-14-27(19-6-8-20(28-2)9-7-19)23-12-10-21(29-3)15-18(23)5-11-24(27)25(26)16-22(17-26)30-4/h6-10,12,15,22H,5,11,13-14,16-17H2,1-4H3/t22?,26-,27?/m0/s1 |
| InChIKey | LLGBURONFMQMDI-WHIIENQPSA-N |
| XLogP | 5.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|