C14H19NO3 — CID 66780961
1-benzyl-3,3-dimethoxypiperidin-4-one (PubChem CID 66780961) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 1-benzyl-3,3-dimethoxypiperidin-4-one.
| Compound Name | 1-benzyl-3,3-dimethoxypiperidin-4-one |
|---|---|
| PubChem CID | 66780961 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-benzyl-3,3-dimethoxypiperidin-4-one |
| SMILES | COC1(OC)CN(Cc2ccccc2)CCC1=O |
| InChI | InChI=1S/C14H19NO3/c1-17-14(18-2)11-15(9-8-13(14)16)10-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | PGOHOWWQLDNIES-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|