C15H23NO4S2 — CID 90585225
4-methylsulfonyl-1-(2,4,5-trimethylphenyl)sulfonylpiperidine (PubChem CID 90585225) has the molecular formula C15H23NO4S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 4-methylsulfonyl-1-(2,4,5-trimethylphenyl)sulfonylpiperidine.
| Compound Name | 4-methylsulfonyl-1-(2,4,5-trimethylphenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 90585225 |
| Molecular Formula | C15H23NO4S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 4-methylsulfonyl-1-(2,4,5-trimethylphenyl)sulfonylpiperidine |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(S(C)(=O)=O)CC2)cc1C |
| InChI | InChI=1S/C15H23NO4S2/c1-11-9-13(3)15(10-12(11)2)22(19,20)16-7-5-14(6-8-16)21(4,17)18/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | KYAITCPLZPXGNZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |