C12H18O2 — CID 57165916
6-cyclopentyloxy-1-methoxycyclohexa-1,4-diene (PubChem CID 57165916) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 6-cyclopentyloxy-1-methoxycyclohexa-1,4-diene.
| Compound Name | 6-cyclopentyloxy-1-methoxycyclohexa-1,4-diene |
|---|---|
| PubChem CID | 57165916 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 6-cyclopentyloxy-1-methoxycyclohexa-1,4-diene |
| SMILES | COC1=CCC=CC1OC1CCCC1 |
| InChI | InChI=1S/C12H18O2/c1-13-11-8-4-5-9-12(11)14-10-6-2-3-7-10/h5,8-10,12H,2-4,6-7H2,1H3 |
| InChIKey | LBJAAKCREDBLSZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|