C10H16 — CID 156675048
(1Z,4Z)-1,6-dimethylcycloocta-1,4-diene (PubChem CID 156675048) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is (1Z,4Z)-1,6-dimethylcycloocta-1,4-diene.
| Compound Name | (1Z,4Z)-1,6-dimethylcycloocta-1,4-diene |
|---|---|
| PubChem CID | 156675048 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (1Z,4Z)-1,6-dimethylcycloocta-1,4-diene |
| SMILES | C/C1=C/C/C=C\C(C)CC1 |
| InChI | InChI=1S/C10H16/c1-9-5-3-4-6-10(2)8-7-9/h3,5-6,9H,4,7-8H2,1-2H3/b5-3-,10-6- |
| InChIKey | QGMKZSWBKKQAIC-XYWNUQEVSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|