C20H34O2 — CID 23427729
(1S,3aR,4E,6R,9E,12aR)-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol (PubChem CID 23427729) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,3aR,4E,6R,9E,12aR)-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol.
| Compound Name | (1S,3aR,4E,6R,9E,12aR)-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol |
|---|---|
| PubChem CID | 23427729 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1S,3aR,4E,6R,9E,12aR)-1-(2-hydroxypropan-2-yl)-3a,6,10-trimethyl-2,3,6,7,8,11,12,12a-octahydrocyclopenta[11]annulen-1-ol |
| SMILES | C/C1=C\CC[C@@H](C)/C=C/[C@@]2(C)CC[C@@](O)(C(C)(C)O)[C@@H]2CC1 |
| InChI | InChI=1S/C20H34O2/c1-15-7-6-8-16(2)11-12-19(5)13-14-20(22,18(3,4)21)17(19)10-9-15/h7,11-12,16-17,21-22H,6,8-10,13-14H2,1-5H3/b12-11+,15-7+/t16-,17-,19+,20+/m1/s1 |
| InChIKey | FRFOGWIJWVRMIV-BLNMWNOFSA-N |
| XLogP | 4.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|