About 5-methylcyclooct-5-ene-1,2-diol
5-methylcyclooct-5-ene-1,2-diol (PubChem CID 68741308) has the molecular formula C9H16O2
and a molecular weight of 156.23 g/mol. Its IUPAC name is 5-methylcyclooct-5-ene-1,2-diol.
Molecular Properties
| Compound Name | 5-methylcyclooct-5-ene-1,2-diol |
| PubChem CID | 68741308 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 5-methylcyclooct-5-ene-1,2-diol |
| SMILES | CC1=CCCC(O)C(O)CC1 |
| InChI | InChI=1S/C9H16O2/c1-7-3-2-4-8(10)9(11)6-5-7/h3,8-11H,2,4-6H2,1H3 |
| InChIKey | GKAUOWMWMGTZMT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylcyclooct-5-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylcyclooct-5-ene-1,2-diol?
The IUPAC name of 5-methylcyclooct-5-ene-1,2-diol (CID 68741308) is 5-methylcyclooct-5-ene-1,2-diol.
What is the SMILES notation for 5-methylcyclooct-5-ene-1,2-diol?
The canonical SMILES for 5-methylcyclooct-5-ene-1,2-diol is CC1=CCCC(O)C(O)CC1.
What is the InChIKey of 5-methylcyclooct-5-ene-1,2-diol?
The InChIKey is GKAUOWMWMGTZMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-7-3-2-4-8(10)9(11)6-5-7/h3,8-11H,2,4-6H2,1H3.
What are the key properties of 5-methylcyclooct-5-ene-1,2-diol?
5-methylcyclooct-5-ene-1,2-diol has a molecular weight of 156.23 g/mol, XLogP of 1.23, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylcyclooct-5-ene-1,2-diol is sourced from PubChem (CID 68741308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).