C13H20O4 — CID 23092778
[(4Z)-8-acetyloxy-5-methylcyclooct-4-en-1-yl] acetate (PubChem CID 23092778) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is [(4Z)-8-acetyloxy-5-methylcyclooct-4-en-1-yl] acetate.
| Compound Name | [(4Z)-8-acetyloxy-5-methylcyclooct-4-en-1-yl] acetate |
|---|---|
| PubChem CID | 23092778 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [(4Z)-8-acetyloxy-5-methylcyclooct-4-en-1-yl] acetate |
| SMILES | CC(=O)OC1CC/C=C(/C)CCC1OC(C)=O |
| InChI | InChI=1S/C13H20O4/c1-9-5-4-6-12(16-10(2)14)13(8-7-9)17-11(3)15/h5,12-13H,4,6-8H2,1-3H3/b9-5- |
| InChIKey | CSSGVLIUGQPJNP-UITAMQMPSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|