C19H30O2 — CID 134735458
[(2E,6E,10E)-3,7,11-trimethylcyclotetradeca-2,6,10-trien-1-yl] acetate (PubChem CID 134735458) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is [(2E,6E,10E)-3,7,11-trimethylcyclotetradeca-2,6,10-trien-1-yl] acetate.
| Compound Name | [(2E,6E,10E)-3,7,11-trimethylcyclotetradeca-2,6,10-trien-1-yl] acetate |
|---|---|
| PubChem CID | 134735458 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | [(2E,6E,10E)-3,7,11-trimethylcyclotetradeca-2,6,10-trien-1-yl] acetate |
| SMILES | CC(=O)OC1/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC1 |
| InChI | InChI=1S/C19H30O2/c1-15-8-5-9-16(2)11-7-13-19(21-18(4)20)14-17(3)12-6-10-15/h9-10,14,19H,5-8,11-13H2,1-4H3/b15-10+,16-9+,17-14+ |
| InChIKey | HJROHJIWKNEPNB-ZBUIQZEKSA-N |
| XLogP | 5.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|